1,3-Dimethoxy-2-nitrobenzene, 98%
cas: 6665-97-0 — see every product listed under this CAS number, including other names
1,3-Dimethoxy-2-nitrobenzene, 98% (CAS 6665-97-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg, 10g, 25g, 100g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A983789-250mg |
| cas | 6665-97-0 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 231.31 Pln | |
| Ambeed | 1g | 259.12 Pln | |
| Ambeed | 5g | 598.44 Pln | |
| BLDpharm | 250mg | 214.39 Pln | |
| BLDpharm | 1g | 269.93 Pln | |
| BLDpharm | 5g | 642.02 Pln | |
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 98.00 Pln | |
| Chemat | 1g | 179.60 Pln | |
| Chemat | 5g | 515.60 Pln | |
| Chemat | 10g | 966.80 Pln | |
| Chemat | 25g | 2138.00 Pln | |
| Fluorochem | 1g | 247.85 Pln | |
| Fluorochem | 5g | 617.51 Pln | |
| Fluorochem | 10g | 1106.92 Pln | |
| Fluorochem | 25g | 2528.29 Pln | |
| Fluorochem | 100g | 7661.90 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
1,3-dimethoxy-2-nitrobenzene (CAS 6665-97-0) is a chemical compound with the molecular formula C8H9NO4 and a molecular weight of 183.16 g/mol. IUPAC name: 1,3-dimethoxy-2-nitrobenzene. InChIKey: MVBXGGHFJZBKFJ-UHFFFAOYSA-N.
| Molecular formula | C8H9NO4 |
|---|---|
| Molecular weight | 183.16 g/mol |
| IUPAC name | 1,3-dimethoxy-2-nitrobenzene |
| InChIKey | MVBXGGHFJZBKFJ-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC=C1)OC)[N+](=O)[O-] |
Computed by PubChem (NCBI)