cas: 6665-97-0 — see every product listed under this CAS number, including other names
1,3-Dimethoxy-2-nitrobenzene, 98% (CAS 6665-97-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F209904-1G |
| cas | 6665-97-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 237.43 Pln | |
| Fluorochem | 5g | 653.95 Pln | |
| Fluorochem | 10g | 1237.08 Pln | |
| Fluorochem | 25g | 2720.93 Pln | |
| Fluorochem | 100g | 7578.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
1,3-dimethoxy-2-nitrobenzene (CAS 6665-97-0) is a chemical compound with the molecular formula C8H9NO4 and a molecular weight of 183.16 g/mol. IUPAC name: 1,3-dimethoxy-2-nitrobenzene. InChIKey: MVBXGGHFJZBKFJ-UHFFFAOYSA-N.
| Molecular formula | C8H9NO4 |
|---|---|
| Molecular weight | 183.16 g/mol |
| IUPAC name | 1,3-dimethoxy-2-nitrobenzene |
| InChIKey | MVBXGGHFJZBKFJ-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC=C1)OC)[N+](=O)[O-] |
Computed by PubChem (NCBI)