cas: 25252-46-4 — see every product listed under this CAS number, including other names
1,3-Dimethyl-1H-thieno[2,3-c]pyrazole-5-carboxylic acid, 98%, 98% (CAS 25252-46-4) is a chemical reagent available from Chemat. Available pack sizes: 10g, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BE4W-10g |
| cas | 25252-46-4 |
| size | 10g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 654.80 Pln | |
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 126.80 Pln | |
| Chemat | 5g | 362.00 Pln | |
| Chemat | 25g | 1538.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1,3-dimethylthieno[3,2-d]pyrazole-5-carboxylic acid (CAS 25252-46-4) is a chemical compound with the molecular formula C8H8N2O2S and a molecular weight of 196.23 g/mol. IUPAC name: 1,3-dimethylthieno[3,2-d]pyrazole-5-carboxylic acid. InChIKey: QRANSYHQSVJLHX-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O2S |
|---|---|
| Molecular weight | 196.23 g/mol |
| IUPAC name | 1,3-dimethylthieno[3,2-d]pyrazole-5-carboxylic acid |
| InChIKey | QRANSYHQSVJLHX-UHFFFAOYSA-N |
| SMILES | CC1=NN(C2=C1C=C(S2)C(=O)O)C |
Computed by PubChem (NCBI)