CAS 858206-54-9 appears in our catalog under these names: 5-Methyl-5-(thiophen-3-yl)imidazolidine-2,4-dione, 95%, 5-Methyl-5-(thiophen-3-yl)imidazolidine-2,4-dione, 5-Methyl-5-(thiophen-3-yl)imidazolidine-2,4-dione, 95%, 95%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
5-methyl-5-thiophen-3-ylimidazolidine-2,4-dione (CAS 858206-54-9) is a chemical compound with the molecular formula C8H8N2O2S and a molecular weight of 196.23 g/mol. IUPAC name: 5-methyl-5-thiophen-3-ylimidazolidine-2,4-dione. InChIKey: PUTWZZJHSOQALV-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O2S |
|---|---|
| Molecular weight | 196.23 g/mol |
| IUPAC name | 5-methyl-5-thiophen-3-ylimidazolidine-2,4-dione |
| InChIKey | PUTWZZJHSOQALV-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)NC(=O)N1)C2=CSC=C2 |
Computed by PubChem (NCBI)