CAS 25252-46-4 appears in our catalog under these names: 1,3-Dimethyl-1h-thieno[2,3-c]pyrazole-5-carboxylic acid, 97%, 1,3–Dimethyl–1H–thieno(2,3–c)pyrazole–5–carboxylic acid, 1,3-Dimethyl-1H-thieno[2,3-c]pyrazole-5-carboxylic acid, 95% , 1,3-Dimethyl-1H-thieno[2,3-c]pyrazole-5-carboxylic acid 98%, 1,3-Dimethyl-1H-thieno[2,3-c]pyrazole-5-carboxylic acid, 98%, 98%. Offered by: Combi-blocks, GLPBio, Thermo Scientific, Ambeed, Chemat. Available pack sizes: 25g, 5g, 1g, 250mg, 10g.
1,3-dimethylthieno[3,2-d]pyrazole-5-carboxylic acid (CAS 25252-46-4) is a chemical compound with the molecular formula C8H8N2O2S and a molecular weight of 196.23 g/mol. IUPAC name: 1,3-dimethylthieno[3,2-d]pyrazole-5-carboxylic acid. InChIKey: QRANSYHQSVJLHX-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O2S |
|---|---|
| Molecular weight | 196.23 g/mol |
| IUPAC name | 1,3-dimethylthieno[3,2-d]pyrazole-5-carboxylic acid |
| InChIKey | QRANSYHQSVJLHX-UHFFFAOYSA-N |
| SMILES | CC1=NN(C2=C1C=C(S2)C(=O)O)C |
Computed by PubChem (NCBI)