CAS 502649-08-3 appears in our catalog under these names: 6-Ethyl-1h,2h,3h,4h-thieno[2,3-d]pyrimidine-2,4-dione, 95%, 6-Ethyl-1H,2H,3H,4H-thieno(2,3-d)pyrimidine-2,4-dione, 95%, 6-Ethylthieno(2,3-d)pyrimidine-2,4(1H,3H)-dione. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 100mg, 5g, 250mg, 2,5g.
6-ethyl-1H-thieno[2,3-d]pyrimidine-2,4-dione (CAS 502649-08-3) is a chemical compound with the molecular formula C8H8N2O2S and a molecular weight of 196.23 g/mol. IUPAC name: 6-ethyl-1H-thieno[2,3-d]pyrimidine-2,4-dione. InChIKey: POPVVTFLBAWPMC-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O2S |
|---|---|
| Molecular weight | 196.23 g/mol |
| IUPAC name | 6-ethyl-1H-thieno[2,3-d]pyrimidine-2,4-dione |
| InChIKey | POPVVTFLBAWPMC-UHFFFAOYSA-N |
| SMILES | CCC1=CC2=C(S1)NC(=O)NC2=O |
Computed by PubChem (NCBI)