cas: 4845-49-2 — see every product listed under this CAS number, including other names
1,3-Diphenyl-1H-Pyrazol-5(4H)-One, 98%, 98% (CAS 4845-49-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch117WTO-100mg |
| cas | 4845-49-2 |
| size | 100mg |
| availability | 12g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 112.40 Pln | |
| Chemat | 250mg | 170.00 Pln | |
| Chemat | 1g | 381.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2,5-diphenyl-4H-pyrazol-3-one (CAS 4845-49-2) is a chemical compound with the molecular formula C15H12N2O and a molecular weight of 236.27 g/mol. IUPAC name: 2,5-diphenyl-4H-pyrazol-3-one. InChIKey: MZKALFCNIJHTJG-UHFFFAOYSA-N.
| Molecular formula | C15H12N2O |
|---|---|
| Molecular weight | 236.27 g/mol |
| IUPAC name | 2,5-diphenyl-4H-pyrazol-3-one |
| InChIKey | MZKALFCNIJHTJG-UHFFFAOYSA-N |
| SMILES | C1C(=NN(C1=O)C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)