CAS 4845-49-2 appears in our catalog under these names: 2,5-Diphenyl-2,4-dihydro-pyrazol-3-one, 95%, 1,3-Diphenyl-4,5-dihydro-1H-pyrazol-5-one, 1,3-Diphenyl-1H-Pyrazol-5(4H)-One, 98%, 98%. Offered by: Combi-blocks, Biosynth, Chemat. Available pack sizes: 1g, 250mg, 100mg, 5g, 10g.
2,5-diphenyl-4H-pyrazol-3-one (CAS 4845-49-2) is a chemical compound with the molecular formula C15H12N2O and a molecular weight of 236.27 g/mol. IUPAC name: 2,5-diphenyl-4H-pyrazol-3-one. InChIKey: MZKALFCNIJHTJG-UHFFFAOYSA-N.
| Molecular formula | C15H12N2O |
|---|---|
| Molecular weight | 236.27 g/mol |
| IUPAC name | 2,5-diphenyl-4H-pyrazol-3-one |
| InChIKey | MZKALFCNIJHTJG-UHFFFAOYSA-N |
| SMILES | C1C(=NN(C1=O)C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)