CAS 52392-73-1 appears in our catalog under these names: 3,4-Diphenylisoxazol-5-amine, 95%, 3,4-Diphenylisoxazol-5-amine, 95+%, Diphenyl-1,2-oxazol-5-amine. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g, 2,5g.
3,4-diphenyl-1,2-oxazol-5-amine (CAS 52392-73-1) is a chemical compound with the molecular formula C15H12N2O and a molecular weight of 236.27 g/mol. IUPAC name: 3,4-diphenyl-1,2-oxazol-5-amine. InChIKey: OJHYWOWFEGPIQA-UHFFFAOYSA-N.
| Molecular formula | C15H12N2O |
|---|---|
| Molecular weight | 236.27 g/mol |
| IUPAC name | 3,4-diphenyl-1,2-oxazol-5-amine |
| InChIKey | OJHYWOWFEGPIQA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(ON=C2C3=CC=CC=C3)N |
Computed by PubChem (NCBI)