CAS 1198412-58-6 is the registry number for Perampanel Impurity 36. Offered by: Chemat Brand. Available pack sizes: on request.
1-phenyl-5-pyridin-3-ylpyridin-2-one (CAS 1198412-58-6) is a chemical compound with the molecular formula C16H12N2O and a molecular weight of 248.28 g/mol. IUPAC name: 1-phenyl-5-pyridin-3-ylpyridin-2-one. InChIKey: HEOSIUZNFCYUDL-UHFFFAOYSA-N.
| Molecular formula | C16H12N2O |
|---|---|
| Molecular weight | 248.28 g/mol |
| IUPAC name | 1-phenyl-5-pyridin-3-ylpyridin-2-one |
| InChIKey | HEOSIUZNFCYUDL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C=C(C=CC2=O)C3=CN=CC=C3 |
Computed by PubChem (NCBI)