cas: 2964-48-9 — see every product listed under this CAS number, including other names
1,3-Propanediol, 2-amino-1-(4-nitrophenyl)-, (1S,2S)-, 98%, 98% (CAS 2964-48-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 50g, 100g, 500g, 1kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114BJ5-5g |
| cas | 2964-48-9 |
| size | 5g |
| availability | 5000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 74.00 Pln | |
| Chemat | 10g | 74.00 Pln | |
| Chemat | 25g | 78.80 Pln | |
| Chemat | 50g | 102.80 Pln | |
| Chemat | 100g | 102.80 Pln | |
| Chemat | 500g | 278.40 Pln | |
| Chemat | 1kg | 424.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(1S,2S)-2-amino-1-(4-nitrophenyl)propane-1,3-diol (CAS 2964-48-9) is a chemical compound with the molecular formula C9H12N2O4 and a molecular weight of 212.20 g/mol. IUPAC name: (1S,2S)-2-amino-1-(4-nitrophenyl)propane-1,3-diol. InChIKey: OCYJXSUPZMNXEN-IUCAKERBSA-N.
| Molecular formula | C9H12N2O4 |
|---|---|
| Molecular weight | 212.20 g/mol |
| IUPAC name | (1S,2S)-2-amino-1-(4-nitrophenyl)propane-1,3-diol |
| InChIKey | OCYJXSUPZMNXEN-IUCAKERBSA-N |
| SMILES | C1=CC(=CC=C1[C@@H]([C@H](CO)N)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)