cas: 2964-48-9 — see every product listed under this CAS number, including other names
(1S,2S)-(+)-2-Amino-1-(4-nitrophenyl)-1,3-propanediol, 95% (CAS 2964-48-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 10g, 25g, 100g, 500g, 1kg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F078888-1G |
| cas | 2964-48-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 81.24 Pln | |
| Fluorochem | 10g | 91.65 Pln | |
| Fluorochem | 25g | 96.86 Pln | |
| Fluorochem | 100g | 143.72 Pln | |
| Fluorochem | 500g | 320.74 Pln | |
| Fluorochem | 1kg | 581.06 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
(1S,2S)-2-amino-1-(4-nitrophenyl)propane-1,3-diol (CAS 2964-48-9) is a chemical compound with the molecular formula C9H12N2O4 and a molecular weight of 212.20 g/mol. IUPAC name: (1S,2S)-2-amino-1-(4-nitrophenyl)propane-1,3-diol. InChIKey: OCYJXSUPZMNXEN-IUCAKERBSA-N.
| Molecular formula | C9H12N2O4 |
|---|---|
| Molecular weight | 212.20 g/mol |
| IUPAC name | (1S,2S)-2-amino-1-(4-nitrophenyl)propane-1,3-diol |
| InChIKey | OCYJXSUPZMNXEN-IUCAKERBSA-N |
| SMILES | C1=CC(=CC=C1[C@@H]([C@H](CO)N)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)