cas: 27299-12-3 — see every product listed under this CAS number, including other names
1,4-Anhydro-D-glucitol, 98% (CAS 27299-12-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F636835-100MG |
| cas | 27299-12-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 529.00 Pln | |
| Fluorochem | 250mg | 971.55 Pln | |
| Fluorochem | 1g | 2976.05 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(2R,3R,4S)-2-[(1R)-1,2-dihydroxyethyl]oxolane-3,4-diol (CAS 27299-12-3) is a chemical compound with the molecular formula C6H12O5 and a molecular weight of 164.16 g/mol. IUPAC name: (2R,3R,4S)-2-[(1R)-1,2-dihydroxyethyl]oxolane-3,4-diol. InChIKey: JNYAEWCLZODPBN-JGWLITMVSA-N.
| Molecular formula | C6H12O5 |
|---|---|
| Molecular weight | 164.16 g/mol |
| IUPAC name | (2R,3R,4S)-2-[(1R)-1,2-dihydroxyethyl]oxolane-3,4-diol |
| InChIKey | JNYAEWCLZODPBN-JGWLITMVSA-N |
| SMILES | C1[C@@H]([C@H]([C@H](O1)[C@@H](CO)O)O)O |
Computed by PubChem (NCBI)