CAS 7726-97-8 appears in our catalog under these names: 1,4-Anhydro-D-mannitol, (2R)–2–(1,2–dihydroxyethyl)tetrahydrofuran–3,4–diol. Offered by: TRC, GLPBio, Biosynth, Chemat. Available pack sizes: 100mg, 500mg, 1g, 250mg, 50mg, 1000mg.
(2R,3R,4R)-2-[(1R)-1,2-dihydroxyethyl]oxolane-3,4-diol (CAS 7726-97-8) is a chemical compound with the molecular formula C6H12O5 and a molecular weight of 164.16 g/mol. IUPAC name: (2R,3R,4R)-2-[(1R)-1,2-dihydroxyethyl]oxolane-3,4-diol. InChIKey: JNYAEWCLZODPBN-KVTDHHQDSA-N.
| Molecular formula | C6H12O5 |
|---|---|
| Molecular weight | 164.16 g/mol |
| IUPAC name | (2R,3R,4R)-2-[(1R)-1,2-dihydroxyethyl]oxolane-3,4-diol |
| InChIKey | JNYAEWCLZODPBN-KVTDHHQDSA-N |
| SMILES | C1[C@H]([C@H]([C@H](O1)[C@@H](CO)O)O)O |
Computed by PubChem (NCBI)