Products 1338564-44-5
CAS 1338564-44-5 is the registry number for 1,1,1,3,3,3-Hexafluoro-2-[4-(hydroxymethyl)phenyl]propan-2-ol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1,1,1,3,3,3-hexafluoro-2-[4-(hydroxymethyl)phenyl]propan-2-ol (CAS 1338564-44-5) is a chemical compound with the molecular formula C10H8F6O2 and a molecular weight of 274.16 g/mol. IUPAC name: 1,1,1,3,3,3-hexafluoro-2-[4-(hydroxymethyl)phenyl]propan-2-ol. InChIKey: KVGBWHWVZSBSHZ-UHFFFAOYSA-N.
| Molecular formula | C10H8F6O2 |
|---|---|
| Molecular weight | 274.16 g/mol |
| IUPAC name | 1,1,1,3,3,3-hexafluoro-2-[4-(hydroxymethyl)phenyl]propan-2-ol |
| InChIKey | KVGBWHWVZSBSHZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CO)C(C(F)(F)F)(C(F)(F)F)O |
Computed by PubChem (NCBI)