CAS 1805405-28-0 appears in our catalog under these names: 2,4-Bis(trifluoromethyl)-6-methoxybenzyl alcohol, 95%, (2-Methoxy-4,6-bis(trifluoromethyl)phenyl)methanol, 97%, (2-Methoxy-4,6-bis(trifluoromethyl)phenyl)methanol, ≥95%, ≥95%, 2,4-Bis(trifluoromethyl)-6-methoxybenzyl alcohol. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 10g, 1g, 250mg.
[2-methoxy-4,6-bis(trifluoromethyl)phenyl]methanol (CAS 1805405-28-0) is a chemical compound with the molecular formula C10H8F6O2 and a molecular weight of 274.16 g/mol. IUPAC name: [2-methoxy-4,6-bis(trifluoromethyl)phenyl]methanol. InChIKey: SRMNLLQJGUACBA-UHFFFAOYSA-N.
| Molecular formula | C10H8F6O2 |
|---|---|
| Molecular weight | 274.16 g/mol |
| IUPAC name | [2-methoxy-4,6-bis(trifluoromethyl)phenyl]methanol |
| InChIKey | SRMNLLQJGUACBA-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1CO)C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)