Products 1032638-88-2
CAS 1032638-88-2 appears in our catalog under these names: 1-(Methoxymethoxy)-3,5-bis(trifluoromethyl)-benzene, 97%, 1-(Methoxymethoxy)-3,5-bis(trifluoromethyl)-benzene. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 10g, 100g, 25g, 5g, 1g.
1-(methoxymethoxy)-3,5-bis(trifluoromethyl)benzene (CAS 1032638-88-2) is a chemical compound with the molecular formula C10H8F6O2 and a molecular weight of 274.16 g/mol. IUPAC name: 1-(methoxymethoxy)-3,5-bis(trifluoromethyl)benzene. InChIKey: WHIBVHZPQNMYHW-UHFFFAOYSA-N.
| Molecular formula | C10H8F6O2 |
|---|---|
| Molecular weight | 274.16 g/mol |
| IUPAC name | 1-(methoxymethoxy)-3,5-bis(trifluoromethyl)benzene |
| InChIKey | WHIBVHZPQNMYHW-UHFFFAOYSA-N |
| SMILES | COCOC1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)