cas: 68-36-0 — see every product listed under this CAS number, including other names
1,4-Bis(trichloromethyl)benzene, 98%(GC), 98%(GC) (CAS 68-36-0) is a chemical reagent available from Chemat. Available pack sizes: 25g, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114DN4-25g |
| cas | 68-36-0 |
| size | 25g |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25g | 659.60 Pln | |
| Chemat | 1g | 126.80 Pln | |
| Chemat | 5g | 285.20 Pln |
| purity | 98%(GC) |
|---|---|
| delivery time | 3 weeks |
1,4-bis(trichloromethyl)benzene (CAS 68-36-0) is a chemical compound with the molecular formula C8H4Cl6 and a molecular weight of 312.8 g/mol. IUPAC name: 1,4-bis(trichloromethyl)benzene. InChIKey: OTEKOJQFKOIXMU-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl6 |
|---|---|
| Molecular weight | 312.8 g/mol |
| IUPAC name | 1,4-bis(trichloromethyl)benzene |
| InChIKey | OTEKOJQFKOIXMU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(Cl)(Cl)Cl)C(Cl)(Cl)Cl |
Computed by PubChem (NCBI)