CAS 881-99-2 appears in our catalog under these names: Alpha,alpha,alpha,alpha',alpha',alpha'-hexachloro-m-xylene, 98%, 1,3-Bis(trichloromethyl)benzene, 98+%, 1,3-Bis(trichloromethyl)benzene. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 25g, 5g, 1g.
1,3-bis(trichloromethyl)benzene (CAS 881-99-2) is a chemical compound with the molecular formula C8H4Cl6 and a molecular weight of 312.8 g/mol. IUPAC name: 1,3-bis(trichloromethyl)benzene. InChIKey: GGZIUXGYCNYNNV-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl6 |
|---|---|
| Molecular weight | 312.8 g/mol |
| IUPAC name | 1,3-bis(trichloromethyl)benzene |
| InChIKey | GGZIUXGYCNYNNV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(Cl)(Cl)Cl)C(Cl)(Cl)Cl |
Computed by PubChem (NCBI)