CAS 1133-57-9 appears in our catalog under these names: Alpha,alpha',2,4,5,6-hexachloro-m-xylene, 98%, Alpha,alpha,2,4,5,6-hexachloro-m-xylene, 98% GC. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 1g, 5g.
1,2,3,5-tetrachloro-4,6-bis(chloromethyl)benzene (CAS 1133-57-9) is a chemical compound with the molecular formula C8H4Cl6 and a molecular weight of 312.8 g/mol. IUPAC name: 1,2,3,5-tetrachloro-4,6-bis(chloromethyl)benzene. InChIKey: YDNRGDROSRCQRU-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl6 |
|---|---|
| Molecular weight | 312.8 g/mol |
| IUPAC name | 1,2,3,5-tetrachloro-4,6-bis(chloromethyl)benzene |
| InChIKey | YDNRGDROSRCQRU-UHFFFAOYSA-N |
| SMILES | C(C1=C(C(=C(C(=C1Cl)Cl)Cl)CCl)Cl)Cl |
Computed by PubChem (NCBI)