CAS 1079-17-0 appears in our catalog under these names: Alpha,alpha',2,3,5,6-hexachloro-p-xylene, 95%, α,α′,2,3,5,6–Hexachloro–p–xylene, alpha,alpha'-2,3,5,6-Hexachloro-p-xylene, alpha,alpha',2,3,5,6-Hexachloro-p-xylene, >98.0%(GC), 1,2,4,5-Tetrachloro-3,6-bis(chloromethyl)benzene 98%. Offered by: Combi-blocks, GLPBio, Biosynth, TCI, Ambeed. Available pack sizes: 1g, 10g, 5g, 2g, 25g, 250mg.
1,2,4,5-tetrachloro-3,6-bis(chloromethyl)benzene (CAS 1079-17-0) is a chemical compound with the molecular formula C8H4Cl6 and a molecular weight of 312.8 g/mol. IUPAC name: 1,2,4,5-tetrachloro-3,6-bis(chloromethyl)benzene. InChIKey: IYGDLOMSJZQSGY-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl6 |
|---|---|
| Molecular weight | 312.8 g/mol |
| IUPAC name | 1,2,4,5-tetrachloro-3,6-bis(chloromethyl)benzene |
| InChIKey | IYGDLOMSJZQSGY-UHFFFAOYSA-N |
| SMILES | C(C1=C(C(=C(C(=C1Cl)Cl)CCl)Cl)Cl)Cl |
Computed by PubChem (NCBI)