cas: 1605-18-1 — see every product listed under this CAS number, including other names
1,4-Di(prop-1-en-2-yl)benzene 98% mix TBC as stabilizer (CAS 1605-18-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A601497-1g |
| cas | 1605-18-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 225.75 Pln | |
| Ambeed | 5g | 698.56 Pln | |
| Ambeed | 25g | 2111.44 Pln |
| purity | 98% mix TBC as stabilizer |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A601497 |
1,4-bis(prop-1-en-2-yl)benzene (CAS 1605-18-1) is a chemical compound with the molecular formula C12H14 and a molecular weight of 158.24 g/mol. IUPAC name: 1,4-bis(prop-1-en-2-yl)benzene. InChIKey: ZENYUPUKNXGVDY-UHFFFAOYSA-N.
| Molecular formula | C12H14 |
|---|---|
| Molecular weight | 158.24 g/mol |
| IUPAC name | 1,4-bis(prop-1-en-2-yl)benzene |
| InChIKey | ZENYUPUKNXGVDY-UHFFFAOYSA-N |
| SMILES | CC(=C)C1=CC=C(C=C1)C(=C)C |
Computed by PubChem (NCBI)