cas: 64728-49-0 — see every product listed under this CAS number, including other names
1,4-Di(pyridin-2-yl)piperazine, ≥97-<99% (CAS 64728-49-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 50g, 100g. Offered by: Hoffman Fine Chemicals.
| brand | Hoffman Fine Chemicals |
|---|---|
| catalog number | HFC6093-97-99-5g |
| cas | 64728-49-0 |
| size | 5g |
| availability | 3-4 tygodnie|3-4 weeks |
| brand | size | price | |
|---|---|---|---|
| Hoffman Fine Chemicals | 5g | 4952.64 Pln | |
| Hoffman Fine Chemicals | 10g | 7747.08 Pln | |
| Hoffman Fine Chemicals | 25g | 15179.78 Pln | |
| Hoffman Fine Chemicals | 50g | 24105.40 Pln | |
| Hoffman Fine Chemicals | 100g | 38383.84 Pln |
| purity | ≥97-<99% |
|---|---|
| category | Chemicals |
| delivery time | 3-4 weeks |
1,4-dipyridin-2-ylpiperazine (CAS 64728-49-0) is a chemical compound with the molecular formula C14H16N4 and a molecular weight of 240.30 g/mol. IUPAC name: 1,4-dipyridin-2-ylpiperazine. InChIKey: GMNOIEBLHFKZLT-UHFFFAOYSA-N.
| Molecular formula | C14H16N4 |
|---|---|
| Molecular weight | 240.30 g/mol |
| IUPAC name | 1,4-dipyridin-2-ylpiperazine |
| InChIKey | GMNOIEBLHFKZLT-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1C2=CC=CC=N2)C3=CC=CC=N3 |
Computed by PubChem (NCBI)