cas: 64728-49-0 — see every product listed under this CAS number, including other names
1,4-Dipyridin-2-yl-piperazine, 97% (CAS 64728-49-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F080157-100MG |
| cas | 64728-49-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 372.80 Pln | |
| Fluorochem | 250mg | 612.30 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
1,4-dipyridin-2-ylpiperazine (CAS 64728-49-0) is a chemical compound with the molecular formula C14H16N4 and a molecular weight of 240.30 g/mol. IUPAC name: 1,4-dipyridin-2-ylpiperazine. InChIKey: GMNOIEBLHFKZLT-UHFFFAOYSA-N.
| Molecular formula | C14H16N4 |
|---|---|
| Molecular weight | 240.30 g/mol |
| IUPAC name | 1,4-dipyridin-2-ylpiperazine |
| InChIKey | GMNOIEBLHFKZLT-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1C2=CC=CC=N2)C3=CC=CC=N3 |
Computed by PubChem (NCBI)