cas: 1012-72-2 — see every product listed under this CAS number, including other names
1,4-Di-tert-butylbenzene, >99.0%(GC) (CAS 1012-72-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | D2111-5G |
| cas | 1012-72-2 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 216.69 Pln | |
| TCI | 25g | 664.16 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >99.0%(GC) |
1,4-ditert-butylbenzene (CAS 1012-72-2) is a chemical compound with the molecular formula C14H22 and a molecular weight of 190.32 g/mol. IUPAC name: 1,4-ditert-butylbenzene. InChIKey: OOWNNCMFKFBNOF-UHFFFAOYSA-N.
| Molecular formula | C14H22 |
|---|---|
| Molecular weight | 190.32 g/mol |
| IUPAC name | 1,4-ditert-butylbenzene |
| InChIKey | OOWNNCMFKFBNOF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C(C)(C)C |
Computed by PubChem (NCBI)