cas: 1012-72-2 — see every product listed under this CAS number, including other names
1,4-Di-tert-butylbenzene, 99.89% (CAS 1012-72-2) is a chemical reagent available from Chemat. Available pack sizes: 5 g, 25 g, 10 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W087058-5 g |
| cas | 1012-72-2 |
| size | 5 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 5 g | 361.49 Pln | |
| MedChemExpress | 25 g | 886.26 Pln | |
| MedChemExpress | 10 g | 505.45 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.89% |
1,4-ditert-butylbenzene (CAS 1012-72-2) is a chemical compound with the molecular formula C14H22 and a molecular weight of 190.32 g/mol. IUPAC name: 1,4-ditert-butylbenzene. InChIKey: OOWNNCMFKFBNOF-UHFFFAOYSA-N.
| Molecular formula | C14H22 |
|---|---|
| Molecular weight | 190.32 g/mol |
| IUPAC name | 1,4-ditert-butylbenzene |
| InChIKey | OOWNNCMFKFBNOF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C(C)(C)C |
Computed by PubChem (NCBI)