cas: 119752-83-9 — see every product listed under this CAS number, including other names
1,4-Diazabicyclo[2.2.2]octane-1,4-diium-1,4-disulfinate, 95% (CAS 119752-83-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 15g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F464913-250MG |
| cas | 119752-83-9 |
| size | 250mg |
| availability | In Stock UK |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 102.07 Pln | |
| Fluorochem | 1g | 107.27 Pln | |
| Fluorochem | 5g | 133.30 Pln | |
| Fluorochem | 10g | 206.20 Pln | |
| Fluorochem | 15g | 247.85 Pln | |
| Fluorochem | 25g | 341.56 Pln | |
| Fluorochem | 100g | 1164.19 Pln | |
| Fluorochem | 500g | 4616.10 Pln |
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 1-2 weeks |
| category | Odczynniki chemiczne |
1,4-diazoniabicyclo[2.2.2]octane-1,4-disulfinate (CAS 119752-83-9) is a chemical compound with the molecular formula C6H12N2O4S2 and a molecular weight of 240.3 g/mol. IUPAC name: 1,4-diazoniabicyclo[2.2.2]octane-1,4-disulfinate. InChIKey: RWISEVUOFYXWFO-UHFFFAOYSA-N.
| Molecular formula | C6H12N2O4S2 |
|---|---|
| Molecular weight | 240.3 g/mol |
| IUPAC name | 1,4-diazoniabicyclo[2.2.2]octane-1,4-disulfinate |
| InChIKey | RWISEVUOFYXWFO-UHFFFAOYSA-N |
| SMILES | C1C[N+]2(CC[N+]1(CC2)S(=O)[O-])S(=O)[O-] |
Computed by PubChem (NCBI)