cas: 1646-54-4 — see every product listed under this CAS number, including other names
1,4-Dibromo-2,3,5,6-tetramethylbenzene, 98%, 98% (CAS 1646-54-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112UZ8-1g |
| cas | 1646-54-4 |
| size | 1g |
| availability | 1000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 88.40 Pln | |
| Chemat | 10g | 107.60 Pln | |
| Chemat | 25g | 170.00 Pln | |
| Chemat | 100g | 477.20 Pln | |
| Chemat | 500g | 2198.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1,4-dibromo-2,3,5,6-tetramethylbenzene (CAS 1646-54-4) is a chemical compound with the molecular formula C10H12Br2 and a molecular weight of 292.01 g/mol. IUPAC name: 1,4-dibromo-2,3,5,6-tetramethylbenzene. InChIKey: IEWAQZBDJDWANM-UHFFFAOYSA-N.
| Molecular formula | C10H12Br2 |
|---|---|
| Molecular weight | 292.01 g/mol |
| IUPAC name | 1,4-dibromo-2,3,5,6-tetramethylbenzene |
| InChIKey | IEWAQZBDJDWANM-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=C1Br)C)C)Br)C |
Computed by PubChem (NCBI)