cas: 1646-54-4 — see every product listed under this CAS number, including other names
1,4-Dibromo-2,3,5,6-tetramethylbenzene, >98.0%(GC) (CAS 1646-54-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | D5168-1G |
| cas | 1646-54-4 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 167.52 Pln | |
| TCI | 5g | 482.22 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC) |
1,4-dibromo-2,3,5,6-tetramethylbenzene (CAS 1646-54-4) is a chemical compound with the molecular formula C10H12Br2 and a molecular weight of 292.01 g/mol. IUPAC name: 1,4-dibromo-2,3,5,6-tetramethylbenzene. InChIKey: IEWAQZBDJDWANM-UHFFFAOYSA-N.
| Molecular formula | C10H12Br2 |
|---|---|
| Molecular weight | 292.01 g/mol |
| IUPAC name | 1,4-dibromo-2,3,5,6-tetramethylbenzene |
| InChIKey | IEWAQZBDJDWANM-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=C1Br)C)C)Br)C |
Computed by PubChem (NCBI)