cas: 1646-54-4 — see every product listed under this CAS number, including other names
1,4-Dibromo-2,3,5,6-tetramethylbenzene, 95% (CAS 1646-54-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F222096-1G |
| cas | 1646-54-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 96.86 Pln | |
| Fluorochem | 5g | 102.07 Pln | |
| Fluorochem | 10g | 128.10 Pln | |
| Fluorochem | 25g | 216.61 Pln | |
| Fluorochem | 100g | 685.19 Pln | |
| Fluorochem | 500g | 2580.36 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
1,4-dibromo-2,3,5,6-tetramethylbenzene (CAS 1646-54-4) is a chemical compound with the molecular formula C10H12Br2 and a molecular weight of 292.01 g/mol. IUPAC name: 1,4-dibromo-2,3,5,6-tetramethylbenzene. InChIKey: IEWAQZBDJDWANM-UHFFFAOYSA-N.
| Molecular formula | C10H12Br2 |
|---|---|
| Molecular weight | 292.01 g/mol |
| IUPAC name | 1,4-dibromo-2,3,5,6-tetramethylbenzene |
| InChIKey | IEWAQZBDJDWANM-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=C1Br)C)C)Br)C |
Computed by PubChem (NCBI)