cas: 7657-09-2 — see every product listed under this CAS number, including other names
1,4-Dibromo-2-(trifluoromethyl)benzene 98% (CAS 7657-09-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A303214-5g |
| cas | 7657-09-2 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 120.06 Pln | |
| Ambeed | 10g | 131.19 Pln | |
| Ambeed | 25g | 147.88 Pln | |
| Ambeed | 100g | 331.44 Pln | |
| Ambeed | 500g | 1010.06 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A303214 |
1,4-dibromo-2-(trifluoromethyl)benzene (CAS 7657-09-2) is a chemical compound with the molecular formula C7H3Br2F3 and a molecular weight of 303.90 g/mol. IUPAC name: 1,4-dibromo-2-(trifluoromethyl)benzene. InChIKey: VWKFJAOCLPPQGR-UHFFFAOYSA-N.
| Molecular formula | C7H3Br2F3 |
|---|---|
| Molecular weight | 303.90 g/mol |
| IUPAC name | 1,4-dibromo-2-(trifluoromethyl)benzene |
| InChIKey | VWKFJAOCLPPQGR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)C(F)(F)F)Br |
Computed by PubChem (NCBI)