cas: 7657-09-2 — see every product listed under this CAS number, including other names
2,5-Dibromobenzotrifluoride, 96% (CAS 7657-09-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F009124-5G |
| cas | 7657-09-2 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 96.86 Pln | |
| Fluorochem | 10g | 107.27 Pln | |
| Fluorochem | 25g | 133.30 Pln | |
| Fluorochem | 100g | 320.74 Pln |
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
1,4-dibromo-2-(trifluoromethyl)benzene (CAS 7657-09-2) is a chemical compound with the molecular formula C7H3Br2F3 and a molecular weight of 303.90 g/mol. IUPAC name: 1,4-dibromo-2-(trifluoromethyl)benzene. InChIKey: VWKFJAOCLPPQGR-UHFFFAOYSA-N.
| Molecular formula | C7H3Br2F3 |
|---|---|
| Molecular weight | 303.90 g/mol |
| IUPAC name | 1,4-dibromo-2-(trifluoromethyl)benzene |
| InChIKey | VWKFJAOCLPPQGR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)C(F)(F)F)Br |
Computed by PubChem (NCBI)