cas: 170011-47-9 — see every product listed under this CAS number, including other names
1,4-Dioxaspiro[4.5]dec-7-en-8-yl Trifluoromethanesulfonate, 95%, 95% (CAS 170011-47-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11AM4G-100mg |
| cas | 170011-47-9 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 309.20 Pln | |
| Chemat | 250mg | 477.20 Pln | |
| Chemat | 1g | 1182.80 Pln | |
| Chemat | 5g | 3990.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1,4-dioxaspiro[4.5]dec-7-en-8-yl trifluoromethanesulfonate (CAS 170011-47-9) is a chemical compound with the molecular formula C9H11F3O5S and a molecular weight of 288.24 g/mol. IUPAC name: 1,4-dioxaspiro[4.5]dec-7-en-8-yl trifluoromethanesulfonate. InChIKey: NOLMGELTBIIGOL-UHFFFAOYSA-N.
| Molecular formula | C9H11F3O5S |
|---|---|
| Molecular weight | 288.24 g/mol |
| IUPAC name | 1,4-dioxaspiro[4.5]dec-7-en-8-yl trifluoromethanesulfonate |
| InChIKey | NOLMGELTBIIGOL-UHFFFAOYSA-N |
| SMILES | C1CC2(CC=C1OS(=O)(=O)C(F)(F)F)OCCO2 |
Computed by PubChem (NCBI)