cas: 170011-47-9 — see every product listed under this CAS number, including other names
1,4-Dioxaspiro[4.5]dec-7-en-8-yl trifluoromethanesulfonate 95% (CAS 170011-47-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A546416-100mg |
| cas | 170011-47-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 375.94 Pln | |
| Ambeed | 250mg | 437.12 Pln | |
| Ambeed | 1g | 1277.06 Pln | |
| Ambeed | 5g | 3685.62 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A546416 |
1,4-dioxaspiro[4.5]dec-7-en-8-yl trifluoromethanesulfonate (CAS 170011-47-9) is a chemical compound with the molecular formula C9H11F3O5S and a molecular weight of 288.24 g/mol. IUPAC name: 1,4-dioxaspiro[4.5]dec-7-en-8-yl trifluoromethanesulfonate. InChIKey: NOLMGELTBIIGOL-UHFFFAOYSA-N.
| Molecular formula | C9H11F3O5S |
|---|---|
| Molecular weight | 288.24 g/mol |
| IUPAC name | 1,4-dioxaspiro[4.5]dec-7-en-8-yl trifluoromethanesulfonate |
| InChIKey | NOLMGELTBIIGOL-UHFFFAOYSA-N |
| SMILES | C1CC2(CC=C1OS(=O)(=O)C(F)(F)F)OCCO2 |
Computed by PubChem (NCBI)