cas: 132465-62-4 — see every product listed under this CAS number, including other names
1,5-Diphenyl-4,5-dihydro-1H-pyrazole-3-carboxylic acid, 97% (CAS 132465-62-4) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A701686-10g |
| cas | 132465-62-4 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 17842.30 Pln | |
| AmBeed | 5g | 11495.05 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
2,3-diphenyl-3,4-dihydropyrazole-5-carboxylic acid (CAS 132465-62-4) is a chemical compound with the molecular formula C16H14N2O2 and a molecular weight of 266.29 g/mol. IUPAC name: 2,3-diphenyl-3,4-dihydropyrazole-5-carboxylic acid. InChIKey: NXFXMRQTSCVALM-UHFFFAOYSA-N.
| Molecular formula | C16H14N2O2 |
|---|---|
| Molecular weight | 266.29 g/mol |
| IUPAC name | 2,3-diphenyl-3,4-dihydropyrazole-5-carboxylic acid |
| InChIKey | NXFXMRQTSCVALM-UHFFFAOYSA-N |
| SMILES | C1C(N(N=C1C(=O)O)C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)