Products 292062-25-0

CAS 292062-25-0 is the registry number for 1-Benzyl-2-methylbenzodiazole-5-carboxylic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.

Structural formula: {0} (CAS {1})

1-benzyl-2-methylbenzimidazole-5-carboxylic acid (CAS 292062-25-0) is a chemical compound with the molecular formula C16H14N2O2 and a molecular weight of 266.29 g/mol. IUPAC name: 1-benzyl-2-methylbenzimidazole-5-carboxylic acid. InChIKey: VYSLIEFTLBFUIJ-UHFFFAOYSA-N.

Identity
Molecular formulaC16H14N2O2
Molecular weight266.29 g/mol
IUPAC name1-benzyl-2-methylbenzimidazole-5-carboxylic acid
InChIKeyVYSLIEFTLBFUIJ-UHFFFAOYSA-N
SMILESCC1=NC2=C(N1CC3=CC=CC=C3)C=CC(=C2)C(=O)O

Computed by PubChem (NCBI)