Products 132465-62-4
CAS 132465-62-4 appears in our catalog under these names: 1,5-Diphenyl-4,5-dihydro-1h-pyrazole-3-carboxylic acid, 95%, 1,5-Diphenyl-4,5-dihydro-1H-pyrazole-3-carboxylic acid, 97%, 1,5-Diphenyl-4,5-dihydro-1H-pyrazole-3-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g.
2,3-diphenyl-3,4-dihydropyrazole-5-carboxylic acid (CAS 132465-62-4) is a chemical compound with the molecular formula C16H14N2O2 and a molecular weight of 266.29 g/mol. IUPAC name: 2,3-diphenyl-3,4-dihydropyrazole-5-carboxylic acid. InChIKey: NXFXMRQTSCVALM-UHFFFAOYSA-N.
| Molecular formula | C16H14N2O2 |
|---|---|
| Molecular weight | 266.29 g/mol |
| IUPAC name | 2,3-diphenyl-3,4-dihydropyrazole-5-carboxylic acid |
| InChIKey | NXFXMRQTSCVALM-UHFFFAOYSA-N |
| SMILES | C1C(N(N=C1C(=O)O)C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)