CAS 65361-84-4 appears in our catalog under these names: 1–(4–(Benzyloxy)–1H–indazol–1–yl)ethanone, 1-(4-(Benzyloxy)-1h-indazol-1-yl)ethanone, 95%, 1-(4-(Benzyloxy)-1H-indazol-1-yl)ethanone, 95%, 95%. Offered by: GLPBio, Combi-blocks, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g.
1-(4-phenylmethoxyindazol-1-yl)ethanone (CAS 65361-84-4) is a chemical compound with the molecular formula C16H14N2O2 and a molecular weight of 266.29 g/mol. IUPAC name: 1-(4-phenylmethoxyindazol-1-yl)ethanone. InChIKey: QSJAYNUXMYHEFZ-UHFFFAOYSA-N.
| Molecular formula | C16H14N2O2 |
|---|---|
| Molecular weight | 266.29 g/mol |
| IUPAC name | 1-(4-phenylmethoxyindazol-1-yl)ethanone |
| InChIKey | QSJAYNUXMYHEFZ-UHFFFAOYSA-N |
| SMILES | CC(=O)N1C2=C(C=N1)C(=CC=C2)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)