cas: 538-62-5 — see every product listed under this CAS number, including other names
1,5-Diphenylcarbazone (CAS 538-62-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 500g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch11DDUT-1g |
| cas | 538-62-5 |
| size | 1g |
| availability | 1000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 88.40 Pln | |
| Chemat | 5g | 98.00 Pln | |
| Chemat | 25g | 126.80 Pln | |
| Chemat | 100g | 342.80 Pln | |
| Fluorochem | 1g | 122.89 Pln | |
| Fluorochem | 5g | 133.30 Pln | |
| Fluorochem | 25g | 268.67 Pln | |
| Fluorochem | 100g | 716.43 Pln | |
| Fluorochem | 500g | 1684.84 Pln |
| delivery time | 3 weeks |
|---|
1-anilino-3-phenyliminourea (CAS 538-62-5) is a chemical compound with the molecular formula C13H12N4O and a molecular weight of 240.26 g/mol. IUPAC name: 1-anilino-3-phenyliminourea. InChIKey: ZFWAHZCOKGWUIT-UHFFFAOYSA-N.
| Molecular formula | C13H12N4O |
|---|---|
| Molecular weight | 240.26 g/mol |
| IUPAC name | 1-anilino-3-phenyliminourea |
| InChIKey | ZFWAHZCOKGWUIT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NNC(=O)N=NC2=CC=CC=C2 |
Computed by PubChem (NCBI)