cas: 27973-29-1 — see every product listed under this CAS number, including other names
1,6-Dibromopyrene, 99% (CAS 27973-29-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Thermo Scientific (Acros).
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 470980010 |
| cas | 27973-29-1 |
| size | 1g |
| availability | availability |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 1g | 285.08 Pln | |
| Thermo Scientific (Acros) | 5g | 917.62 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 99% |
1,6-dibromopyrene (CAS 27973-29-1) is a chemical compound with the molecular formula C16H8Br2 and a molecular weight of 360.04 g/mol. IUPAC name: 1,6-dibromopyrene. InChIKey: JRCJYPMNBNNCFE-UHFFFAOYSA-N.
| Molecular formula | C16H8Br2 |
|---|---|
| Molecular weight | 360.04 g/mol |
| IUPAC name | 1,6-dibromopyrene |
| InChIKey | JRCJYPMNBNNCFE-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC3=C2C4=C1C=CC(=C4C=C3)Br)Br |
Computed by PubChem (NCBI)