1,6-Dibromopyrene, 99%, 99%
cas: 27973-29-1 — see every product listed under this CAS number, including other names
1,6-Dibromopyrene, 99%, 99% (CAS 27973-29-1) is a chemical reagent available from Chemat. Available pack sizes: 1kg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1149UE-1kg |
| cas | 27973-29-1 |
| size | 1kg |
| availability | 2000g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 1kg | 6928.40 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 112.40 Pln | |
| Chemat | 10g | 165.20 Pln | |
| Chemat | 25g | 290.00 Pln | |
| Chemat | 100g | 976.40 Pln | |
| Chemat | 500g | 4348.80 Pln |
properties
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
1,6-dibromopyrene (CAS 27973-29-1) is a chemical compound with the molecular formula C16H8Br2 and a molecular weight of 360.04 g/mol. IUPAC name: 1,6-dibromopyrene. InChIKey: JRCJYPMNBNNCFE-UHFFFAOYSA-N.
| Molecular formula | C16H8Br2 |
|---|---|
| Molecular weight | 360.04 g/mol |
| IUPAC name | 1,6-dibromopyrene |
| InChIKey | JRCJYPMNBNNCFE-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC3=C2C4=C1C=CC(=C4C=C3)Br)Br |
Computed by PubChem (NCBI)