1,6-Dibromopyrene, 98%
cas: 27973-29-1 — see every product listed under this CAS number, including other names
1,6-Dibromopyrene, 98% (CAS 27973-29-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 1kg. Offered by: Fluorochem, Ambeed.
| brand | Fluorochem |
|---|---|
| catalog number | F214669-1G |
| cas | 27973-29-1 |
| size | 1g |
| availability | In Stock Germany |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 169.75 Pln | |
| Fluorochem | 10g | 185.37 Pln | |
| Fluorochem | 25g | 367.60 Pln | |
| Fluorochem | 100g | 1294.35 Pln | |
| Fluorochem | 500g | 6105.16 Pln | |
| Ambeed | 1g | 125.62 Pln | |
| Ambeed | 5g | 175.69 Pln | |
| Ambeed | 10g | 197.94 Pln | |
| Ambeed | 25g | 381.50 Pln | |
| Ambeed | 100g | 1316.00 Pln | |
| Ambeed | 500g | 6283.31 Pln | |
| Ambeed | 1kg | 10010.19 Pln |
properties
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 5-10 days |
| category | Odczynniki chemiczne |
1,6-dibromopyrene (CAS 27973-29-1) is a chemical compound with the molecular formula C16H8Br2 and a molecular weight of 360.04 g/mol. IUPAC name: 1,6-dibromopyrene. InChIKey: JRCJYPMNBNNCFE-UHFFFAOYSA-N.
| Molecular formula | C16H8Br2 |
|---|---|
| Molecular weight | 360.04 g/mol |
| IUPAC name | 1,6-dibromopyrene |
| InChIKey | JRCJYPMNBNNCFE-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC3=C2C4=C1C=CC(=C4C=C3)Br)Br |
Computed by PubChem (NCBI)