cas: 27973-29-1 — see every product listed under this CAS number, including other names
1,6-Dibromopyrene, 98% (CAS 27973-29-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F214669-1G |
| cas | 27973-29-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 96.86 Pln | |
| Fluorochem | 5g | 159.34 Pln | |
| Fluorochem | 10g | 174.96 Pln | |
| Fluorochem | 25g | 351.98 Pln | |
| Fluorochem | 100g | 1226.67 Pln | |
| Fluorochem | 500g | 5917.73 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
1,6-dibromopyrene (CAS 27973-29-1) is a chemical compound with the molecular formula C16H8Br2 and a molecular weight of 360.04 g/mol. IUPAC name: 1,6-dibromopyrene. InChIKey: JRCJYPMNBNNCFE-UHFFFAOYSA-N.
| Molecular formula | C16H8Br2 |
|---|---|
| Molecular weight | 360.04 g/mol |
| IUPAC name | 1,6-dibromopyrene |
| InChIKey | JRCJYPMNBNNCFE-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC3=C2C4=C1C=CC(=C4C=C3)Br)Br |
Computed by PubChem (NCBI)