cas: 53454-78-7 — see every product listed under this CAS number, including other names
1,6-Diphenylhexane-1,3,4,6-tetraone 95+% (CAS 53454-78-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A527423-250mg |
| cas | 53454-78-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 303.62 Pln | |
| Ambeed | 1g | 609.56 Pln | |
| Ambeed | 5g | 1738.75 Pln |
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A527423 |
1,6-diphenylhexane-1,3,4,6-tetrone (CAS 53454-78-7) is a chemical compound with the molecular formula C18H14O4 and a molecular weight of 294.3 g/mol. IUPAC name: 1,6-diphenylhexane-1,3,4,6-tetrone. InChIKey: DXOCHFDLWWHNBR-UHFFFAOYSA-N.
| Molecular formula | C18H14O4 |
|---|---|
| Molecular weight | 294.3 g/mol |
| IUPAC name | 1,6-diphenylhexane-1,3,4,6-tetrone |
| InChIKey | DXOCHFDLWWHNBR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)CC(=O)C(=O)CC(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)