CAS 19806-12-3 is the registry number for Dibenzylidene-Succinic Acid. Offered by: Chemat Brand. Available pack sizes: on request.
(2E,3E)-2,3-dibenzylidenebutanedioic acid (CAS 19806-12-3) is a chemical compound with the molecular formula C18H14O4 and a molecular weight of 294.3 g/mol. IUPAC name: (2E,3E)-2,3-dibenzylidenebutanedioic acid. InChIKey: YRCUGKQNIYGAON-JOBJLJCHSA-N.
| Molecular formula | C18H14O4 |
|---|---|
| Molecular weight | 294.3 g/mol |
| IUPAC name | (2E,3E)-2,3-dibenzylidenebutanedioic acid |
| InChIKey | YRCUGKQNIYGAON-JOBJLJCHSA-N |
| SMILES | C1=CC=C(C=C1)/C=C(/C(=O)O)\C(=C/C2=CC=CC=C2)\C(=O)O |
Computed by PubChem (NCBI)