CAS 53454-78-7 appears in our catalog under these names: 1,6-Diphenylhexane-1,3,4,6-tetrone, 95%, 1,6-Diphenylhexane-1,3,4,6-tetraone 95+%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 5g, 10g, 250mg, 25g, 1g.
1,6-diphenylhexane-1,3,4,6-tetrone (CAS 53454-78-7) is a chemical compound with the molecular formula C18H14O4 and a molecular weight of 294.3 g/mol. IUPAC name: 1,6-diphenylhexane-1,3,4,6-tetrone. InChIKey: DXOCHFDLWWHNBR-UHFFFAOYSA-N.
| Molecular formula | C18H14O4 |
|---|---|
| Molecular weight | 294.3 g/mol |
| IUPAC name | 1,6-diphenylhexane-1,3,4,6-tetrone |
| InChIKey | DXOCHFDLWWHNBR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)CC(=O)C(=O)CC(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)