CAS 484-33-3 appears in our catalog under these names: 3-hydroxy-3-(4-methoxy-1-benzofuran-5-yl)-1-phenylprop-2-en-1-one, 98%, Pongamol, 95%, Pongamol, >95% (HPLC), Pongamol/ 99.57% (existing batch purity), Pongamol. Offered by: Fluorochem, Combi-blocks, TRC, TargetMol, GLPBio. Available pack sizes: 250mg, 1g, 5g, 10mg, 50mg, 25mg, 100mg, 5mg.
1-(4-methoxy-1-benzofuran-5-yl)-3-phenylpropane-1,3-dione (CAS 484-33-3) is a chemical compound with the molecular formula C18H14O4 and a molecular weight of 294.3 g/mol. IUPAC name: 1-(4-methoxy-1-benzofuran-5-yl)-3-phenylpropane-1,3-dione. InChIKey: XTLSKKJNOIMMBK-UHFFFAOYSA-N.
| Molecular formula | C18H14O4 |
|---|---|
| Molecular weight | 294.3 g/mol |
| IUPAC name | 1-(4-methoxy-1-benzofuran-5-yl)-3-phenylpropane-1,3-dione |
| InChIKey | XTLSKKJNOIMMBK-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC2=C1C=CO2)C(=O)CC(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)