CAS 553663-65-3 appears in our catalog under these names: 1,8-Dibromo-9H-carbazole, 97%, 97%, 1,8-DIBROMO-9H-CARBAZOLE, 98%, 1,8-Dibromo-9H-carbazole, 97%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 10g, 5g.
1,8-dibromo-9H-carbazole (CAS 553663-65-3) is a chemical compound with the molecular formula C12H7Br2N and a molecular weight of 325.00 g/mol. IUPAC name: 1,8-dibromo-9H-carbazole. InChIKey: SAGKZGMCGWAMEE-UHFFFAOYSA-N.
| Molecular formula | C12H7Br2N |
|---|---|
| Molecular weight | 325.00 g/mol |
| IUPAC name | 1,8-dibromo-9H-carbazole |
| InChIKey | SAGKZGMCGWAMEE-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Br)NC3=C2C=CC=C3Br |
Computed by PubChem (NCBI)