CAS 1356059-56-7 appears in our catalog under these names: 2,3-Dibromo-9H-carbazole 98%, 2,3-Dibromo-9H-carbazole, 98%, 98%, 2,3-Dibromo-9H-carbazole, 98%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
2,3-dibromo-9H-carbazole (CAS 1356059-56-7) is a chemical compound with the molecular formula C12H7Br2N and a molecular weight of 325.00 g/mol. IUPAC name: 2,3-dibromo-9H-carbazole. InChIKey: IBWIWKZZWKIBNP-UHFFFAOYSA-N.
| Molecular formula | C12H7Br2N |
|---|---|
| Molecular weight | 325.00 g/mol |
| IUPAC name | 2,3-dibromo-9H-carbazole |
| InChIKey | IBWIWKZZWKIBNP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=CC(=C(C=C3N2)Br)Br |
Computed by PubChem (NCBI)