CAS 133753-43-2 is the registry number for 3,5-Dibromo-9H-carbazole, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
3,5-dibromo-9H-carbazole (CAS 133753-43-2) is a chemical compound with the molecular formula C12H7Br2N and a molecular weight of 325.00 g/mol. IUPAC name: 3,5-dibromo-9H-carbazole. InChIKey: HXOBCWWZMWUVFN-UHFFFAOYSA-N.
| Molecular formula | C12H7Br2N |
|---|---|
| Molecular weight | 325.00 g/mol |
| IUPAC name | 3,5-dibromo-9H-carbazole |
| InChIKey | HXOBCWWZMWUVFN-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Br)C3=C(N2)C=CC(=C3)Br |
Computed by PubChem (NCBI)