Products 133753-43-2

CAS 133753-43-2 is the registry number for 3,5-Dibromo-9H-carbazole, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.

Structural formula: {0} (CAS {1})

3,5-dibromo-9H-carbazole (CAS 133753-43-2) is a chemical compound with the molecular formula C12H7Br2N and a molecular weight of 325.00 g/mol. IUPAC name: 3,5-dibromo-9H-carbazole. InChIKey: HXOBCWWZMWUVFN-UHFFFAOYSA-N.

Identity
Molecular formulaC12H7Br2N
Molecular weight325.00 g/mol
IUPAC name3,5-dibromo-9H-carbazole
InChIKeyHXOBCWWZMWUVFN-UHFFFAOYSA-N
SMILESC1=CC2=C(C(=C1)Br)C3=C(N2)C=CC(=C3)Br

Computed by PubChem (NCBI)