CAS 6825-20-3 appears in our catalog under these names: 3,6-Dibromo-9H-carbazole, 3,6–Dibromocarbazole, 3,6-Dibromocarbazole/ 99.18% (existing batch purity), 3,6-Dibromocarbazole, 99% , 3,6-Dibromocarbazole. Offered by: TRC, GLPBio, TargetMol, Thermo Scientific (Alfa Aesar), Biosynth. Available pack sizes: 10g, 1g, 5g, 100g, 500g, 25g, 0,05kg, 0,1kg.
3,6-dibromo-9H-carbazole (CAS 6825-20-3) is a chemical compound with the molecular formula C12H7Br2N and a molecular weight of 325.00 g/mol. IUPAC name: 3,6-dibromo-9H-carbazole. InChIKey: FIHILUSWISKVSR-UHFFFAOYSA-N.
| Molecular formula | C12H7Br2N |
|---|---|
| Molecular weight | 325.00 g/mol |
| IUPAC name | 3,6-dibromo-9H-carbazole |
| InChIKey | FIHILUSWISKVSR-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)C3=C(N2)C=CC(=C3)Br |
Computed by PubChem (NCBI)