CAS 102587-98-4 appears in our catalog under these names: 2,7-Dibromopyrene, 2,7–Dibromopyrene, 2,7-Dibromopyrene, >98.0%(HPLC), 2,7-Dibromopyrene 95%, 2,7-dibromo-Pyrene, 95%, 95%. Offered by: TRC, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 100mg, 10mg, 50mg, 1g, 5g, 250mg, 10g, 25g.
2,7-dibromopyrene (CAS 102587-98-4) is a chemical compound with the molecular formula C16H8Br2 and a molecular weight of 360.04 g/mol. IUPAC name: 2,7-dibromopyrene. InChIKey: IGTQPXMEWQTTBJ-UHFFFAOYSA-N.
| Molecular formula | C16H8Br2 |
|---|---|
| Molecular weight | 360.04 g/mol |
| IUPAC name | 2,7-dibromopyrene |
| InChIKey | IGTQPXMEWQTTBJ-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=CC3=C2C4=C(C=C3)C=C(C=C41)Br)Br |
Computed by PubChem (NCBI)